propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate

C14H17NO4 — CID 14988500

IUPACpropan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate
SMILESCC(C)OC(=O)[C@@H]1CC(=O)N1OCc1ccccc1
InChIInChI=1S/C14H17NO4/c1-10(2)19-14(17)12-8-13(16)15(12)18-9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3/t12-/m0/s1
InChIKeyUXPMVRRAWMGHFA-LBPRGKRZSA-N
MW263.29 g/mol
LogP1.67
Rot. Bonds5

About propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate

propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate (PubChem CID 14988500) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate.

Molecular Properties

Compound Namepropan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate
PubChem CID14988500
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Namepropan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate
SMILESCC(C)OC(=O)[C@@H]1CC(=O)N1OCc1ccccc1
InChIInChI=1S/C14H17NO4/c1-10(2)19-14(17)12-8-13(16)15(12)18-9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3/t12-/m0/s1
InChIKeyUXPMVRRAWMGHFA-LBPRGKRZSA-N
XLogP1.67
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 51.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate?
The IUPAC name of propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate (CID 14988500) is propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate.
What is the SMILES notation for propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate?
The canonical SMILES for propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate is CC(C)OC(=O)[C@@H]1CC(=O)N1OCc1ccccc1.
What is the InChIKey of propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate?
The InChIKey is UXPMVRRAWMGHFA-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H17NO4/c1-10(2)19-14(17)12-8-13(16)15(12)18-9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3/t12-/m0/s1.
What are the key properties of propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate?
propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate has a molecular weight of 263.29 g/mol, XLogP of 1.67, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2S)-4-oxo-1-phenylmethoxyazetidine-2-carboxylate is sourced from PubChem (CID 14988500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).