C17H22ClNO5 — CID 133056045
1-O-benzyl 4-O-propan-2-yl 3-oxopiperidine-1,4-dicarboxylate;hydrochloride (PubChem CID 133056045) has the molecular formula C17H22ClNO5 and a molecular weight of 355.82 g/mol. Its IUPAC name is 1-O-benzyl 4-O-propan-2-yl 3-oxopiperidine-1,4-dicarboxylate;hydrochloride.
| Compound Name | 1-O-benzyl 4-O-propan-2-yl 3-oxopiperidine-1,4-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 133056045 |
| Molecular Formula | C17H22ClNO5 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 1-O-benzyl 4-O-propan-2-yl 3-oxopiperidine-1,4-dicarboxylate;hydrochloride |
| SMILES | CC(C)OC(=O)C1CCN(C(=O)OCc2ccccc2)CC1=O.Cl |
| InChI | InChI=1S/C17H21NO5.ClH/c1-12(2)23-16(20)14-8-9-18(10-15(14)19)17(21)22-11-13-6-4-3-5-7-13;/h3-7,12,14H,8-11H2,1-2H3;1H |
| InChIKey | SGQAQNBLLSYSLC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|