C48H62O6 — CID 164911900
2-[2-(ethoxymethoxy)-3-[(2R,3R)-4-[2-(ethoxymethoxy)-3-(2,4,6-trimethylphenyl)phenyl]-2,3-bis(2-methylprop-2-enoxy)butyl]phenyl]-1,3,5-trimethylbenzene (PubChem CID 164911900) has the molecular formula C48H62O6 and a molecular weight of 735.02 g/mol. Its IUPAC name is 2-[2-(ethoxymethoxy)-3-[(2R,3R)-4-[2-(ethoxymethoxy)-3-(2,4,6-trimethylphenyl)phenyl]-2,3-bis(2-methylprop-2-enoxy)butyl]phenyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[2-(ethoxymethoxy)-3-[(2R,3R)-4-[2-(ethoxymethoxy)-3-(2,4,6-trimethylphenyl)phenyl]-2,3-bis(2-methylprop-2-enoxy)butyl]phenyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 164911900 |
| Molecular Formula | C48H62O6 |
| Molecular Weight | 735.02 g/mol |
| Exact Mass | 734.45 |
| IUPAC Name | 2-[2-(ethoxymethoxy)-3-[(2R,3R)-4-[2-(ethoxymethoxy)-3-(2,4,6-trimethylphenyl)phenyl]-2,3-bis(2-methylprop-2-enoxy)butyl]phenyl]-1,3,5-trimethylbenzene |
| SMILES | C=C(C)CO[C@H](Cc1cccc(-c2c(C)cc(C)cc2C)c1OCOCC)[C@@H](Cc1cccc(-c2c(C)cc(C)cc2C)c1OCOCC)OCC(=C)C |
| InChI | InChI=1S/C48H62O6/c1-13-49-29-53-47-39(17-15-19-41(47)45-35(9)21-33(7)22-36(45)10)25-43(51-27-31(3)4)44(52-28-32(5)6)26-40-18-16-20-42(48(40)54-30-50-14-2)46-37(11)23-34(8)24-38(46)12/h15-24,43-44H,3,5,13-14,25-30H2,1-2,4,6-12H3/t43-,44-/m1/s1 |
| InChIKey | CYSTXMDWZDNWOH-NDOUMJCMSA-N |
| XLogP | 11.32 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.02 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|