C22H28I2O6 — CID 172834357
1,4-bis[2-(ethoxymethoxy)-3-iodophenyl]butane-2,3-diol (PubChem CID 172834357) has the molecular formula C22H28I2O6 and a molecular weight of 642.27 g/mol. Its IUPAC name is 1,4-bis[2-(ethoxymethoxy)-3-iodophenyl]butane-2,3-diol.
| Compound Name | 1,4-bis[2-(ethoxymethoxy)-3-iodophenyl]butane-2,3-diol |
|---|---|
| PubChem CID | 172834357 |
| Molecular Formula | C22H28I2O6 |
| Molecular Weight | 642.27 g/mol |
| Exact Mass | 642.00 |
| IUPAC Name | 1,4-bis[2-(ethoxymethoxy)-3-iodophenyl]butane-2,3-diol |
| SMILES | CCOCOc1c(I)cccc1CC(O)C(O)Cc1cccc(I)c1OCOCC |
| InChI | InChI=1S/C22H28I2O6/c1-3-27-13-29-21-15(7-5-9-17(21)23)11-19(25)20(26)12-16-8-6-10-18(24)22(16)30-14-28-4-2/h5-10,19-20,25-26H,3-4,11-14H2,1-2H3 |
| InChIKey | VYIGIMQJFRKZMP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.27 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|