C29H36 — CID 173136650
1,3,5-trimethyl-2-[2-pentyl-6-(2,4,6-trimethylphenyl)phenyl]benzene (PubChem CID 173136650) has the molecular formula C29H36 and a molecular weight of 384.61 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-[2-pentyl-6-(2,4,6-trimethylphenyl)phenyl]benzene.
| Compound Name | 1,3,5-trimethyl-2-[2-pentyl-6-(2,4,6-trimethylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 173136650 |
| Molecular Formula | C29H36 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 1,3,5-trimethyl-2-[2-pentyl-6-(2,4,6-trimethylphenyl)phenyl]benzene |
| SMILES | CCCCCc1cccc(-c2c(C)cc(C)cc2C)c1-c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C29H36/c1-8-9-10-12-25-13-11-14-26(27-21(4)15-19(2)16-22(27)5)29(25)28-23(6)17-20(3)18-24(28)7/h11,13-18H,8-10,12H2,1-7H3 |
| InChIKey | TZZVOJCDKMSBFK-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|