C18H32NZr-5 — CID 58594809
ethane;propyl-(2,4,6-trimethylphenyl)azanide;zirconium (PubChem CID 58594809) has the molecular formula C18H32NZr-5 and a molecular weight of 353.69 g/mol. Its IUPAC name is ethane;propyl-(2,4,6-trimethylphenyl)azanide;zirconium.
| Compound Name | ethane;propyl-(2,4,6-trimethylphenyl)azanide;zirconium |
|---|---|
| PubChem CID | 58594809 |
| Molecular Formula | C18H32NZr-5 |
| Molecular Weight | 353.69 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | ethane;propyl-(2,4,6-trimethylphenyl)azanide;zirconium |
| SMILES | [CH2-]C.[CH2-]C.[CH2-]C.[CH2-]CC[N-]c1c(C)cc(C)cc1C.[Zr] |
| InChI | InChI=1S/C12H17N.3C2H5.Zr/c1-5-6-13-12-10(3)7-9(2)8-11(12)4;3*1-2;/h7-8H,1,5-6H2,2-4H3;3*1H2,2H3;/q-2;3*-1; |
| InChIKey | LMTCYTRAKMMUPD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|