C23H28BLi — CID 10087458
lithium pent-1-ynyl-bis(2,4,6-trimethylphenyl)borane (PubChem CID 10087458) has the molecular formula C23H28BLi and a molecular weight of 322.23 g/mol. Its IUPAC name is lithium pent-1-ynyl-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | lithium pent-1-ynyl-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 10087458 |
| Molecular Formula | C23H28BLi |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | lithium pent-1-ynyl-bis(2,4,6-trimethylphenyl)borane |
| SMILES | [CH2-]CCC#CB(c1c(C)cc(C)cc1C)c1c(C)cc(C)cc1C.[Li+] |
| InChI | InChI=1S/C23H28B.Li/c1-8-9-10-11-24(22-18(4)12-16(2)13-19(22)5)23-20(6)14-17(3)15-21(23)7;/h12-15H,1,8-9H2,2-7H3;/q-1;+1 |
| InChIKey | MHOMVLMAIBNACH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|