C18H25BN2 — CID 101113237
bis(2,4,6-trimethylphenyl)boranylhydrazine (PubChem CID 101113237) has the molecular formula C18H25BN2 and a molecular weight of 280.22 g/mol. Its IUPAC name is bis(2,4,6-trimethylphenyl)boranylhydrazine.
| Compound Name | bis(2,4,6-trimethylphenyl)boranylhydrazine |
|---|---|
| PubChem CID | 101113237 |
| Molecular Formula | C18H25BN2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | bis(2,4,6-trimethylphenyl)boranylhydrazine |
| SMILES | Cc1cc(C)c(B(NN)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C18H25BN2/c1-11-7-13(3)17(14(4)8-11)19(21-20)18-15(5)9-12(2)10-16(18)6/h7-10,21H,20H2,1-6H3 |
| InChIKey | OKRBMDFMLJCNAD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|