C46H52B2 — CID 101364649
[(E)-2-[4-[(E)-2-bis(2,4,6-trimethylphenyl)boranylethenyl]phenyl]ethenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 101364649) has the molecular formula C46H52B2 and a molecular weight of 626.55 g/mol. Its IUPAC name is [(E)-2-[4-[(E)-2-bis(2,4,6-trimethylphenyl)boranylethenyl]phenyl]ethenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [(E)-2-[4-[(E)-2-bis(2,4,6-trimethylphenyl)boranylethenyl]phenyl]ethenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 101364649 |
| Molecular Formula | C46H52B2 |
| Molecular Weight | 626.55 g/mol |
| Exact Mass | 626.43 |
| IUPAC Name | [(E)-2-[4-[(E)-2-bis(2,4,6-trimethylphenyl)boranylethenyl]phenyl]ethenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(/C=C/c2ccc(/C=C/B(c3c(C)cc(C)cc3C)c3c(C)cc(C)cc3C)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C46H52B2/c1-29-21-33(5)43(34(6)22-29)47(44-35(7)23-30(2)24-36(44)8)19-17-41-13-15-42(16-14-41)18-20-48(45-37(9)25-31(3)26-38(45)10)46-39(11)27-32(4)28-40(46)12/h13-28H,1-12H3/b19-17+,20-18+ |
| InChIKey | KMBPZLQKFKDBOF-XPWSMXQVSA-N |
| XLogP | 9.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.55 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|