C46H52B2N2 — CID 101364648
[4-[1-bis(2,4,6-trimethylphenyl)boranyl-4-pyridinylidene]-1-pyridinyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 101364648) has the molecular formula C46H52B2N2 and a molecular weight of 654.56 g/mol. Its IUPAC name is [4-[1-bis(2,4,6-trimethylphenyl)boranyl-4-pyridinylidene]-1-pyridinyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-[1-bis(2,4,6-trimethylphenyl)boranyl-4-pyridinylidene]-1-pyridinyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 101364648 |
| Molecular Formula | C46H52B2N2 |
| Molecular Weight | 654.56 g/mol |
| Exact Mass | 654.43 |
| IUPAC Name | [4-[1-bis(2,4,6-trimethylphenyl)boranyl-4-pyridinylidene]-1-pyridinyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2c(C)cc(C)cc2C)N2C=CC(=C3C=CN(B(c4c(C)cc(C)cc4C)c4c(C)cc(C)cc4C)C=C3)C=C2)c(C)c1 |
| InChI | InChI=1S/C46H52B2N2/c1-29-21-33(5)43(34(6)22-29)47(44-35(7)23-30(2)24-36(44)8)49-17-13-41(14-18-49)42-15-19-50(20-16-42)48(45-37(9)25-31(3)26-38(45)10)46-39(11)27-32(4)28-40(46)12/h13-28H,1-12H3 |
| InChIKey | DXWGDZHUFNIZLN-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.56 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|