C14H22Cl2FeNO — CID 153290983
dichloroiron(1+);4-hydroxypentan-2-yl-(2,4,6-trimethylphenyl)azanide (PubChem CID 153290983) has the molecular formula C14H22Cl2FeNO and a molecular weight of 347.09 g/mol. Its IUPAC name is dichloroiron(1+);4-hydroxypentan-2-yl-(2,4,6-trimethylphenyl)azanide.
| Compound Name | dichloroiron(1+);4-hydroxypentan-2-yl-(2,4,6-trimethylphenyl)azanide |
|---|---|
| PubChem CID | 153290983 |
| Molecular Formula | C14H22Cl2FeNO |
| Molecular Weight | 347.09 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | dichloroiron(1+);4-hydroxypentan-2-yl-(2,4,6-trimethylphenyl)azanide |
| SMILES | Cc1cc(C)c([N-]C(C)CC(C)O)c(C)c1.Cl[Fe+]Cl |
| InChI | InChI=1S/C14H22NO.2ClH.Fe/c1-9-6-10(2)14(11(3)7-9)15-12(4)8-13(5)16;;;/h6-7,12-13,16H,8H2,1-5H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | IYTQUAZZMRPFPP-UHFFFAOYSA-L |
| XLogP | 5.15 |
| TPSA | 34.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.09 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|