C19H34AlNO — CID 5249761
aluminum;carbanide;[2,6-di(propan-2-yl)phenyl]-(4-hydroxypentan-2-yl)azanide (PubChem CID 5249761) has the molecular formula C19H34AlNO and a molecular weight of 319.47 g/mol. Its IUPAC name is aluminum;carbanide;[2,6-di(propan-2-yl)phenyl]-(4-hydroxypentan-2-yl)azanide.
| Compound Name | aluminum;carbanide;[2,6-di(propan-2-yl)phenyl]-(4-hydroxypentan-2-yl)azanide |
|---|---|
| PubChem CID | 5249761 |
| Molecular Formula | C19H34AlNO |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | aluminum;carbanide;[2,6-di(propan-2-yl)phenyl]-(4-hydroxypentan-2-yl)azanide |
| SMILES | CC(O)CC(C)[N-]c1c(C(C)C)cccc1C(C)C.[Al+3].[CH3-].[CH3-] |
| InChI | InChI=1S/C17H28NO.2CH3.Al/c1-11(2)15-8-7-9-16(12(3)4)17(15)18-13(5)10-14(6)19;;;/h7-9,11-14,19H,10H2,1-6H3;2*1H3;/q3*-1;+3 |
| InChIKey | BYOJIHNQPIKBER-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 34.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|