C15H26ClNSiSn — CID 122387275
[2,6-di(propan-2-yl)phenyl]-trimethylsilylazanide;tin(2+);chloride (PubChem CID 122387275) has the molecular formula C15H26ClNSiSn and a molecular weight of 402.63 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl]-trimethylsilylazanide;tin(2+);chloride.
| Compound Name | [2,6-di(propan-2-yl)phenyl]-trimethylsilylazanide;tin(2+);chloride |
|---|---|
| PubChem CID | 122387275 |
| Molecular Formula | C15H26ClNSiSn |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl]-trimethylsilylazanide;tin(2+);chloride |
| SMILES | CC(C)c1cccc(C(C)C)c1[N-][Si](C)(C)C.[Cl-].[Sn+2] |
| InChI | InChI=1S/C15H26NSi.ClH.Sn/c1-11(2)13-9-8-10-14(12(3)4)15(13)16-17(5,6)7;;/h8-12H,1-7H3;1H;/q-1;;+2/p-1 |
| InChIKey | HSYUEHFCPZDMER-UHFFFAOYSA-M |
| XLogP | 2.40 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|