C33H38O4S — CID 145217054
ethane;4-[1-(4-hydroxy-3-methylphenyl)-3,5-bis(4-hydroxyphenyl)pentan-3-yl]-2-methyl-6-sulfanylphenol (PubChem CID 145217054) has the molecular formula C33H38O4S and a molecular weight of 530.73 g/mol. Its IUPAC name is ethane;4-[1-(4-hydroxy-3-methylphenyl)-3,5-bis(4-hydroxyphenyl)pentan-3-yl]-2-methyl-6-sulfanylphenol.
| Compound Name | ethane;4-[1-(4-hydroxy-3-methylphenyl)-3,5-bis(4-hydroxyphenyl)pentan-3-yl]-2-methyl-6-sulfanylphenol |
|---|---|
| PubChem CID | 145217054 |
| Molecular Formula | C33H38O4S |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | ethane;4-[1-(4-hydroxy-3-methylphenyl)-3,5-bis(4-hydroxyphenyl)pentan-3-yl]-2-methyl-6-sulfanylphenol |
| SMILES | CC.Cc1cc(CCC(CCc2ccc(O)cc2)(c2ccc(O)cc2)c2cc(C)c(O)c(S)c2)ccc1O |
| InChI | InChI=1S/C31H32O4S.C2H6/c1-20-17-23(5-12-28(20)34)14-16-31(24-6-10-27(33)11-7-24,15-13-22-3-8-26(32)9-4-22)25-18-21(2)30(35)29(36)19-25;1-2/h3-12,17-19,32-36H,13-16H2,1-2H3;1-2H3 |
| InChIKey | HRMGZPNCOAEVKL-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|