C38H30I6O6 — CID 134270988
benzyl 5-[3,5-bis(4-hydroxy-3,5-diiodophenyl)-3-(4-hydroxy-3-iodo-5-methylphenyl)pentyl]-2-hydroxy-3-iodobenzoate (PubChem CID 134270988) has the molecular formula C38H30I6O6 and a molecular weight of 1344.08 g/mol. Its IUPAC name is benzyl 5-[3,5-bis(4-hydroxy-3,5-diiodophenyl)-3-(4-hydroxy-3-iodo-5-methylphenyl)pentyl]-2-hydroxy-3-iodobenzoate.
| Compound Name | benzyl 5-[3,5-bis(4-hydroxy-3,5-diiodophenyl)-3-(4-hydroxy-3-iodo-5-methylphenyl)pentyl]-2-hydroxy-3-iodobenzoate |
|---|---|
| PubChem CID | 134270988 |
| Molecular Formula | C38H30I6O6 |
| Molecular Weight | 1344.08 g/mol |
| Exact Mass | 1343.63 |
| IUPAC Name | benzyl 5-[3,5-bis(4-hydroxy-3,5-diiodophenyl)-3-(4-hydroxy-3-iodo-5-methylphenyl)pentyl]-2-hydroxy-3-iodobenzoate |
| SMILES | Cc1cc(C(CCc2cc(I)c(O)c(I)c2)(CCc2cc(I)c(O)c(C(=O)OCc3ccccc3)c2)c2cc(I)c(O)c(I)c2)cc(I)c1O |
| InChI | InChI=1S/C38H30I6O6/c1-20-11-24(16-30(42)33(20)45)38(25-17-31(43)36(48)32(44)18-25,10-8-23-14-28(40)35(47)29(41)15-23)9-7-22-12-26(34(46)27(39)13-22)37(49)50-19-21-5-3-2-4-6-21/h2-6,11-18,45-48H,7-10,19H2,1H3 |
| InChIKey | ULWSDXLIKQFWHI-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1344.08 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|