C45H38I4O6S — CID 135173066
benzyl [5-[1-[4-[1,1-bis(4-hydroxy-3-iodo-5-methylphenyl)ethyl]phenyl]-1-(4-hydroxy-3-iodo-5-methylphenyl)ethyl]-2-hydroxy-3-iodophenyl]sulfanylformate (PubChem CID 135173066) has the molecular formula C45H38I4O6S and a molecular weight of 1214.48 g/mol. Its IUPAC name is benzyl [5-[1-[4-[1,1-bis(4-hydroxy-3-iodo-5-methylphenyl)ethyl]phenyl]-1-(4-hydroxy-3-iodo-5-methylphenyl)ethyl]-2-hydroxy-3-iodophenyl]sulfanylformate.
| Compound Name | benzyl [5-[1-[4-[1,1-bis(4-hydroxy-3-iodo-5-methylphenyl)ethyl]phenyl]-1-(4-hydroxy-3-iodo-5-methylphenyl)ethyl]-2-hydroxy-3-iodophenyl]sulfanylformate |
|---|---|
| PubChem CID | 135173066 |
| Molecular Formula | C45H38I4O6S |
| Molecular Weight | 1214.48 g/mol |
| Exact Mass | 1213.86 |
| IUPAC Name | benzyl [5-[1-[4-[1,1-bis(4-hydroxy-3-iodo-5-methylphenyl)ethyl]phenyl]-1-(4-hydroxy-3-iodo-5-methylphenyl)ethyl]-2-hydroxy-3-iodophenyl]sulfanylformate |
| SMILES | Cc1cc(C(C)(c2ccc(C(C)(c3cc(C)c(O)c(I)c3)c3cc(I)c(O)c(SC(=O)OCc4ccccc4)c3)cc2)c2cc(C)c(O)c(I)c2)cc(I)c1O |
| InChI | InChI=1S/C45H38I4O6S/c1-24-15-30(18-34(46)39(24)50)44(4,31-16-25(2)40(51)35(47)19-31)28-11-13-29(14-12-28)45(5,32-17-26(3)41(52)36(48)20-32)33-21-37(49)42(53)38(22-33)56-43(54)55-23-27-9-7-6-8-10-27/h6-22,50-53H,23H2,1-5H3 |
| InChIKey | HVPJPZMOTGTQFU-UHFFFAOYSA-N |
| XLogP | 12.99 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1214.48 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|