C27H44O4 — CID 22769815
ethyl 2-[4-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenoxy]prop-2-enoate (PubChem CID 22769815) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is ethyl 2-[4-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenoxy]prop-2-enoate.
| Compound Name | ethyl 2-[4-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenoxy]prop-2-enoate |
|---|---|
| PubChem CID | 22769815 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | ethyl 2-[4-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenoxy]prop-2-enoate |
| SMILES | C=C(Oc1cc(C(C)(C)CC(C)(C)C)c(O)c(C(C)(C)CC(C)(C)C)c1)C(=O)OCC |
| InChI | InChI=1S/C27H44O4/c1-13-30-23(29)18(2)31-19-14-20(26(9,10)16-24(3,4)5)22(28)21(15-19)27(11,12)17-25(6,7)8/h14-15,28H,2,13,16-17H2,1,3-12H3 |
| InChIKey | OWUWWPHGLURAEJ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|