C26H47NO2 — CID 57001664
4-[(1-hydroxypropylamino)methyl]-2,6-bis(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 57001664) has the molecular formula C26H47NO2 and a molecular weight of 405.67 g/mol. Its IUPAC name is 4-[(1-hydroxypropylamino)methyl]-2,6-bis(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 4-[(1-hydroxypropylamino)methyl]-2,6-bis(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 57001664 |
| Molecular Formula | C26H47NO2 |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 405.36 |
| IUPAC Name | 4-[(1-hydroxypropylamino)methyl]-2,6-bis(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CCC(O)NCc1cc(C(C)(C)CC(C)(C)C)c(O)c(C(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C26H47NO2/c1-12-21(28)27-15-18-13-19(25(8,9)16-23(2,3)4)22(29)20(14-18)26(10,11)17-24(5,6)7/h13-14,21,27-29H,12,15-17H2,1-11H3 |
| InChIKey | LQADGVXBPFQQBG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|