C55H92O6 — CID 139762053
4-[2-[3-[2-[4-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-2,6-bis(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 139762053) has the molecular formula C55H92O6 and a molecular weight of 849.33 g/mol. Its IUPAC name is 4-[2-[3-[2-[4-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-2,6-bis(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 4-[2-[3-[2-[4-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-2,6-bis(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 139762053 |
| Molecular Formula | C55H92O6 |
| Molecular Weight | 849.33 g/mol |
| Exact Mass | 848.69 |
| IUPAC Name | 4-[2-[3-[2-[4-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-2,6-bis(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1cc(CCC2OCC3(CO2)COC(CCc2cc(C(C)(C)CC(C)(C)C)c(O)c(C(C)(C)CC(C)(C)C)c2)OC3)cc(C(C)(C)CC(C)(C)C)c1O |
| InChI | InChI=1S/C55H92O6/c1-47(2,3)29-51(13,14)39-25-37(26-40(45(39)56)52(15,16)30-48(4,5)6)21-23-43-58-33-55(34-59-43)35-60-44(61-36-55)24-22-38-27-41(53(17,18)31-49(7,8)9)46(57)42(28-38)54(19,20)32-50(10,11)12/h25-28,43-44,56-57H,21-24,29-36H2,1-20H3 |
| InChIKey | HHOGMTIVBPIBKJ-UHFFFAOYSA-N |
| XLogP | 14.25 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.33 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |