C40H53N5O6 — CID 161461978
2-nitroaniline;2-[(2-nitrophenyl)diazenyl]-4-(2,4,4-trimethylpentan-2-yl)phenol;4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 161461978) has the molecular formula C40H53N5O6 and a molecular weight of 699.89 g/mol. Its IUPAC name is 2-nitroaniline;2-[(2-nitrophenyl)diazenyl]-4-(2,4,4-trimethylpentan-2-yl)phenol;4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-nitroaniline;2-[(2-nitrophenyl)diazenyl]-4-(2,4,4-trimethylpentan-2-yl)phenol;4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 161461978 |
| Molecular Formula | C40H53N5O6 |
| Molecular Weight | 699.89 g/mol |
| Exact Mass | 699.40 |
| IUPAC Name | 2-nitroaniline;2-[(2-nitrophenyl)diazenyl]-4-(2,4,4-trimethylpentan-2-yl)phenol;4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)c(/N=N/c2ccccc2[N+](=O)[O-])c1.CC(C)(C)CC(C)(C)c1ccc(O)cc1.Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H25N3O3.C14H22O.C6H6N2O2/c1-19(2,3)13-20(4,5)14-10-11-18(24)16(12-14)22-21-15-8-6-7-9-17(15)23(25)26;1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11;7-5-3-1-2-4-6(5)8(9)10/h6-12,24H,13H2,1-5H3;6-9,15H,10H2,1-5H3;1-4H,7H2/b22-21+;; |
| InChIKey | WBXYVLGVUSPLRF-ZPZFBZIMSA-N |
| XLogP | 11.71 |
| TPSA | 177.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.89 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|