C22H31N3O — CID 162523909
2-[(2-aminophenyl)diazenyl]-6-ethyl-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 162523909) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-[(2-aminophenyl)diazenyl]-6-ethyl-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-[(2-aminophenyl)diazenyl]-6-ethyl-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 162523909 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 2-[(2-aminophenyl)diazenyl]-6-ethyl-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CCc1cc(C(C)(C)CC(C)(C)C)cc(/N=N/c2ccccc2N)c1O |
| InChI | InChI=1S/C22H31N3O/c1-7-15-12-16(22(5,6)14-21(2,3)4)13-19(20(15)26)25-24-18-11-9-8-10-17(18)23/h8-13,26H,7,14,23H2,1-6H3/b25-24+ |
| InChIKey | PZWUHHQMILYZMZ-OCOZRVBESA-N |
| XLogP | 6.67 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|