C16H19N3O — CID 139924710
2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol (PubChem CID 139924710) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol.
| Compound Name | 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 139924710 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol |
| SMILES | CCc1cc(/N=N/c2ccccc2O)cc(CC)c1N |
| InChI | InChI=1S/C16H19N3O/c1-3-11-9-13(10-12(4-2)16(11)17)18-19-14-7-5-6-8-15(14)20/h5-10,20H,3-4,17H2,1-2H3/b19-18+ |
| InChIKey | RDPNCPUNAMRFJP-VHEBQXMUSA-N |
| XLogP | 4.51 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|