About 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol
2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol (PubChem CID 139924710) has the molecular formula C16H19N3O
and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol.
Molecular Properties
| Compound Name | 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol |
| PubChem CID | 139924710 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol |
| SMILES | CCc1cc(/N=N/c2ccccc2O)cc(CC)c1N |
| InChI | InChI=1S/C16H19N3O/c1-3-11-9-13(10-12(4-2)16(11)17)18-19-14-7-5-6-8-15(14)20/h5-10,20H,3-4,17H2,1-2H3/b19-18+ |
| InChIKey | RDPNCPUNAMRFJP-VHEBQXMUSA-N |
| XLogP | 4.51 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol?
The IUPAC name of 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol (CID 139924710) is 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol.
What is the SMILES notation for 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol?
The canonical SMILES for 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol is CCc1cc(/N=N/c2ccccc2O)cc(CC)c1N.
What is the InChIKey of 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol?
The InChIKey is RDPNCPUNAMRFJP-VHEBQXMUSA-N. The full InChI is InChI=1S/C16H19N3O/c1-3-11-9-13(10-12(4-2)16(11)17)18-19-14-7-5-6-8-15(14)20/h5-10,20H,3-4,17H2,1-2H3/b19-18+.
What are the key properties of 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol?
2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol has a molecular weight of 269.35 g/mol, XLogP of 4.51, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-3,5-diethylphenyl)diazenyl]phenol is sourced from PubChem (CID 139924710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).