C22H34N2O — CID 159897001
2-amino-4-(2,2-dimethylpropyl)phenol;4-(2,2-dimethylpropyl)aniline (PubChem CID 159897001) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is 2-amino-4-(2,2-dimethylpropyl)phenol;4-(2,2-dimethylpropyl)aniline.
| Compound Name | 2-amino-4-(2,2-dimethylpropyl)phenol;4-(2,2-dimethylpropyl)aniline |
|---|---|
| PubChem CID | 159897001 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | 2-amino-4-(2,2-dimethylpropyl)phenol;4-(2,2-dimethylpropyl)aniline |
| SMILES | CC(C)(C)Cc1ccc(N)cc1.CC(C)(C)Cc1ccc(O)c(N)c1 |
| InChI | InChI=1S/C11H17NO.C11H17N/c1-11(2,3)7-8-4-5-10(13)9(12)6-8;1-11(2,3)8-9-4-6-10(12)7-5-9/h4-6,13H,7,12H2,1-3H3;4-7H,8,12H2,1-3H3 |
| InChIKey | NVLWJGULPUZBRT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|