About 2-amino-4-(2-methylpentyl)phenol;aniline
2-amino-4-(2-methylpentyl)phenol;aniline (PubChem CID 177369380) has the molecular formula C18H26N2O
and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-amino-4-(2-methylpentyl)phenol;aniline.
Molecular Properties
| Compound Name | 2-amino-4-(2-methylpentyl)phenol;aniline |
| PubChem CID | 177369380 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 2-amino-4-(2-methylpentyl)phenol;aniline |
| SMILES | CCCC(C)Cc1ccc(O)c(N)c1.Nc1ccccc1 |
| InChI | InChI=1S/C12H19NO.C6H7N/c1-3-4-9(2)7-10-5-6-12(14)11(13)8-10;7-6-4-2-1-3-5-6/h5-6,8-9,14H,3-4,7,13H2,1-2H3;1-5H,7H2 |
| InChIKey | DZNNZFCCDPBXLN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(2-methylpentyl)phenol;aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(2-methylpentyl)phenol;aniline?
The IUPAC name of 2-amino-4-(2-methylpentyl)phenol;aniline (CID 177369380) is 2-amino-4-(2-methylpentyl)phenol;aniline.
What is the SMILES notation for 2-amino-4-(2-methylpentyl)phenol;aniline?
The canonical SMILES for 2-amino-4-(2-methylpentyl)phenol;aniline is CCCC(C)Cc1ccc(O)c(N)c1.Nc1ccccc1.
What is the InChIKey of 2-amino-4-(2-methylpentyl)phenol;aniline?
The InChIKey is DZNNZFCCDPBXLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO.C6H7N/c1-3-4-9(2)7-10-5-6-12(14)11(13)8-10;7-6-4-2-1-3-5-6/h5-6,8-9,14H,3-4,7,13H2,1-2H3;1-5H,7H2.
What are the key properties of 2-amino-4-(2-methylpentyl)phenol;aniline?
2-amino-4-(2-methylpentyl)phenol;aniline has a molecular weight of 286.42 g/mol, XLogP of 4.22, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(2-methylpentyl)phenol;aniline is sourced from PubChem (CID 177369380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).