C17H27NO3 — CID 158506742
2-amino-4-[(2R)-2,4,5,5-tetramethylhexyl]phenol;carbon dioxide (PubChem CID 158506742) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-amino-4-[(2R)-2,4,5,5-tetramethylhexyl]phenol;carbon dioxide.
| Compound Name | 2-amino-4-[(2R)-2,4,5,5-tetramethylhexyl]phenol;carbon dioxide |
|---|---|
| PubChem CID | 158506742 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 2-amino-4-[(2R)-2,4,5,5-tetramethylhexyl]phenol;carbon dioxide |
| SMILES | CC(C[C@@H](C)Cc1ccc(O)c(N)c1)C(C)(C)C.O=C=O |
| InChI | InChI=1S/C16H27NO.CO2/c1-11(8-12(2)16(3,4)5)9-13-6-7-15(18)14(17)10-13;2-1-3/h6-7,10-12,18H,8-9,17H2,1-5H3;/t11-,12?;/m1./s1 |
| InChIKey | HKOANLHJEYDBKE-BAVFUAOSSA-N |
| XLogP | 3.64 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|