C19H32N2O2 — CID 163510754
2-amino-N-[2-hydroxy-5-[(2S)-2,4,5,5-tetramethylhexyl]phenyl]propanamide (PubChem CID 163510754) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 2-amino-N-[2-hydroxy-5-[(2S)-2,4,5,5-tetramethylhexyl]phenyl]propanamide.
| Compound Name | 2-amino-N-[2-hydroxy-5-[(2S)-2,4,5,5-tetramethylhexyl]phenyl]propanamide |
|---|---|
| PubChem CID | 163510754 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 2-amino-N-[2-hydroxy-5-[(2S)-2,4,5,5-tetramethylhexyl]phenyl]propanamide |
| SMILES | CC(N)C(=O)Nc1cc(C[C@@H](C)CC(C)C(C)(C)C)ccc1O |
| InChI | InChI=1S/C19H32N2O2/c1-12(9-13(2)19(4,5)6)10-15-7-8-17(22)16(11-15)21-18(23)14(3)20/h7-8,11-14,22H,9-10,20H2,1-6H3,(H,21,23)/t12-,13?,14?/m0/s1 |
| InChIKey | DBMGDTMVTPPASP-HSBZDZAISA-N |
| XLogP | 3.93 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|