C10H15ClN2O2 — CID 159728581
2-amino-N-(2-hydroxy-5-methylphenyl)propanamide;hydrochloride (PubChem CID 159728581) has the molecular formula C10H15ClN2O2 and a molecular weight of 230.70 g/mol. Its IUPAC name is 2-amino-N-(2-hydroxy-5-methylphenyl)propanamide;hydrochloride.
| Compound Name | 2-amino-N-(2-hydroxy-5-methylphenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 159728581 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2-amino-N-(2-hydroxy-5-methylphenyl)propanamide;hydrochloride |
| SMILES | Cc1ccc(O)c(NC(=O)C(C)N)c1.Cl |
| InChI | InChI=1S/C10H14N2O2.ClH/c1-6-3-4-9(13)8(5-6)12-10(14)7(2)11;/h3-5,7,13H,11H2,1-2H3,(H,12,14);1H |
| InChIKey | OJARGUDYMPFZQA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|