C20H24N2O4 — CID 20778624
N,N'-bis(2-hydroxy-5-methylphenyl)-2-methylpentanediamide (PubChem CID 20778624) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is N,N'-bis(2-hydroxy-5-methylphenyl)-2-methylpentanediamide.
| Compound Name | N,N'-bis(2-hydroxy-5-methylphenyl)-2-methylpentanediamide |
|---|---|
| PubChem CID | 20778624 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N,N'-bis(2-hydroxy-5-methylphenyl)-2-methylpentanediamide |
| SMILES | Cc1ccc(O)c(NC(=O)CCC(C)C(=O)Nc2cc(C)ccc2O)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-12-4-7-17(23)15(10-12)21-19(25)9-6-14(3)20(26)22-16-11-13(2)5-8-18(16)24/h4-5,7-8,10-11,14,23-24H,6,9H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | PYJHJRUVJURYCQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|