C32H34O9 — CID 69108103
[5-[2-[4-[1,1-bis[3-(dihydroxymethyl)-4-hydroxyphenyl]ethyl]phenyl]propan-2-yl]-2-hydroxyphenyl]methanediol (PubChem CID 69108103) has the molecular formula C32H34O9 and a molecular weight of 562.62 g/mol. Its IUPAC name is [5-[2-[4-[1,1-bis[3-(dihydroxymethyl)-4-hydroxyphenyl]ethyl]phenyl]propan-2-yl]-2-hydroxyphenyl]methanediol.
| Compound Name | [5-[2-[4-[1,1-bis[3-(dihydroxymethyl)-4-hydroxyphenyl]ethyl]phenyl]propan-2-yl]-2-hydroxyphenyl]methanediol |
|---|---|
| PubChem CID | 69108103 |
| Molecular Formula | C32H34O9 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | [5-[2-[4-[1,1-bis[3-(dihydroxymethyl)-4-hydroxyphenyl]ethyl]phenyl]propan-2-yl]-2-hydroxyphenyl]methanediol |
| SMILES | CC(C)(c1ccc(C(C)(c2ccc(O)c(C(O)O)c2)c2ccc(O)c(C(O)O)c2)cc1)c1ccc(O)c(C(O)O)c1 |
| InChI | InChI=1S/C32H34O9/c1-31(2,19-8-11-25(33)22(14-19)28(36)37)17-4-6-18(7-5-17)32(3,20-9-12-26(34)23(15-20)29(38)39)21-10-13-27(35)24(16-21)30(40)41/h4-16,28-30,33-41H,1-3H3 |
| InChIKey | SDNXFIOUMDIBGB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|