C15H23NO2 — CID 106987402
2-(2-amino-3,5-dimethylphenyl)-4,4-dimethylpentanoic acid (PubChem CID 106987402) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-(2-amino-3,5-dimethylphenyl)-4,4-dimethylpentanoic acid.
| Compound Name | 2-(2-amino-3,5-dimethylphenyl)-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 106987402 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-(2-amino-3,5-dimethylphenyl)-4,4-dimethylpentanoic acid |
| SMILES | Cc1cc(C)c(N)c(C(CC(C)(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C15H23NO2/c1-9-6-10(2)13(16)11(7-9)12(14(17)18)8-15(3,4)5/h6-7,12H,8,16H2,1-5H3,(H,17,18) |
| InChIKey | VHTACHNKIRLPRD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|