4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid

C15H23NO2 — CID 65298101

IUPAC4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid
SMILESCc1cc(C)c(C(N)CC(C)(C)C(=O)O)c(C)c1
InChIInChI=1S/C15H23NO2/c1-9-6-10(2)13(11(3)7-9)12(16)8-15(4,5)14(17)18/h6-7,12H,8,16H2,1-5H3,(H,17,18)
InChIKeyZRHXCXDSPMZWGD-UHFFFAOYSA-N
MW249.35 g/mol
LogP3.11
Rot. Bonds4

About 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid

4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid (PubChem CID 65298101) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid.

Molecular Properties

Compound Name4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid
PubChem CID65298101
Molecular FormulaC15H23NO2
Molecular Weight249.35 g/mol
Exact Mass249.17
IUPAC Name4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid
SMILESCc1cc(C)c(C(N)CC(C)(C)C(=O)O)c(C)c1
InChIInChI=1S/C15H23NO2/c1-9-6-10(2)13(11(3)7-9)12(16)8-15(4,5)14(17)18/h6-7,12H,8,16H2,1-5H3,(H,17,18)
InChIKeyZRHXCXDSPMZWGD-UHFFFAOYSA-N
XLogP3.11
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.35
LogP ≤ 53.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid?
The IUPAC name of 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid (CID 65298101) is 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid.
What is the SMILES notation for 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid?
The canonical SMILES for 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid is Cc1cc(C)c(C(N)CC(C)(C)C(=O)O)c(C)c1.
What is the InChIKey of 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid?
The InChIKey is ZRHXCXDSPMZWGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2/c1-9-6-10(2)13(11(3)7-9)12(16)8-15(4,5)14(17)18/h6-7,12H,8,16H2,1-5H3,(H,17,18).
What are the key properties of 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid?
4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid has a molecular weight of 249.35 g/mol, XLogP of 3.11, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid is sourced from PubChem (CID 65298101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).