C15H23NO2 — CID 65298101
4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid (PubChem CID 65298101) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid.
| Compound Name | 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid |
|---|---|
| PubChem CID | 65298101 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 4-amino-2,2-dimethyl-4-(2,4,6-trimethylphenyl)butanoic acid |
| SMILES | Cc1cc(C)c(C(N)CC(C)(C)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C15H23NO2/c1-9-6-10(2)13(11(3)7-9)12(16)8-15(4,5)14(17)18/h6-7,12H,8,16H2,1-5H3,(H,17,18) |
| InChIKey | ZRHXCXDSPMZWGD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |