3-amino-2-(2,3,5-trimethylphenyl)propanoic acid

C12H17NO2 — CID 117296257

IUPAC3-amino-2-(2,3,5-trimethylphenyl)propanoic acid
SMILESCc1cc(C)c(C)c(C(CN)C(=O)O)c1
InChIInChI=1S/C12H17NO2/c1-7-4-8(2)9(3)10(5-7)11(6-13)12(14)15/h4-5,11H,6,13H2,1-3H3,(H,14,15)
InChIKeyLMBWJZPWNCJOTL-UHFFFAOYSA-N
MW207.27 g/mol
LogP1.74
Rot. Bonds3

About 3-amino-2-(2,3,5-trimethylphenyl)propanoic acid

3-amino-2-(2,3,5-trimethylphenyl)propanoic acid (PubChem CID 117296257) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-amino-2-(2,3,5-trimethylphenyl)propanoic acid.

Molecular Properties

Compound Name3-amino-2-(2,3,5-trimethylphenyl)propanoic acid
PubChem CID117296257
Molecular FormulaC12H17NO2
Molecular Weight207.27 g/mol
Exact Mass207.13
IUPAC Name3-amino-2-(2,3,5-trimethylphenyl)propanoic acid
SMILESCc1cc(C)c(C)c(C(CN)C(=O)O)c1
InChIInChI=1S/C12H17NO2/c1-7-4-8(2)9(3)10(5-7)11(6-13)12(14)15/h4-5,11H,6,13H2,1-3H3,(H,14,15)
InChIKeyLMBWJZPWNCJOTL-UHFFFAOYSA-N
XLogP1.74
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.27
LogP ≤ 51.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-amino-2-(2,3,5-trimethylphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-2-(2,3,5-trimethylphenyl)propanoic acid?
The IUPAC name of 3-amino-2-(2,3,5-trimethylphenyl)propanoic acid (CID 117296257) is 3-amino-2-(2,3,5-trimethylphenyl)propanoic acid.
What is the SMILES notation for 3-amino-2-(2,3,5-trimethylphenyl)propanoic acid?
The canonical SMILES for 3-amino-2-(2,3,5-trimethylphenyl)propanoic acid is Cc1cc(C)c(C)c(C(CN)C(=O)O)c1.
What is the InChIKey of 3-amino-2-(2,3,5-trimethylphenyl)propanoic acid?
The InChIKey is LMBWJZPWNCJOTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-7-4-8(2)9(3)10(5-7)11(6-13)12(14)15/h4-5,11H,6,13H2,1-3H3,(H,14,15).
What are the key properties of 3-amino-2-(2,3,5-trimethylphenyl)propanoic acid?
3-amino-2-(2,3,5-trimethylphenyl)propanoic acid has a molecular weight of 207.27 g/mol, XLogP of 1.74, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(2,3,5-trimethylphenyl)propanoic acid is sourced from PubChem (CID 117296257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).