C17H27NO2 — CID 106987557
2-(2-amino-5-tert-butylphenyl)-3,4-dimethylpentanoic acid (PubChem CID 106987557) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-(2-amino-5-tert-butylphenyl)-3,4-dimethylpentanoic acid.
| Compound Name | 2-(2-amino-5-tert-butylphenyl)-3,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 106987557 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-(2-amino-5-tert-butylphenyl)-3,4-dimethylpentanoic acid |
| SMILES | CC(C)C(C)C(C(=O)O)c1cc(C(C)(C)C)ccc1N |
| InChI | InChI=1S/C17H27NO2/c1-10(2)11(3)15(16(19)20)13-9-12(17(4,5)6)7-8-14(13)18/h7-11,15H,18H2,1-6H3,(H,19,20) |
| InChIKey | IEHZSDPTUHCXCR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|