C12H21N3 — CID 66517150
(1R)-1-(2-amino-5-tert-butylphenyl)ethane-1,2-diamine (PubChem CID 66517150) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is (1R)-1-(2-amino-5-tert-butylphenyl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(2-amino-5-tert-butylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66517150 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (1R)-1-(2-amino-5-tert-butylphenyl)ethane-1,2-diamine |
| SMILES | CC(C)(C)c1ccc(N)c([C@@H](N)CN)c1 |
| InChI | InChI=1S/C12H21N3/c1-12(2,3)8-4-5-10(14)9(6-8)11(15)7-13/h4-6,11H,7,13-15H2,1-3H3/t11-/m0/s1 |
| InChIKey | LFAVRJVGLAGCQT-NSHDSACASA-N |
| XLogP | 1.52 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|