C19H23NO4 — CID 90182347
methyl 3-(3-cyclopentyl-1-methoxy-1-oxopropan-2-yl)indole-1-carboxylate (PubChem CID 90182347) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl 3-(3-cyclopentyl-1-methoxy-1-oxopropan-2-yl)indole-1-carboxylate.
| Compound Name | methyl 3-(3-cyclopentyl-1-methoxy-1-oxopropan-2-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 90182347 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | methyl 3-(3-cyclopentyl-1-methoxy-1-oxopropan-2-yl)indole-1-carboxylate |
| SMILES | COC(=O)C(CC1CCCC1)c1cn(C(=O)OC)c2ccccc12 |
| InChI | InChI=1S/C19H23NO4/c1-23-18(21)15(11-13-7-3-4-8-13)16-12-20(19(22)24-2)17-10-6-5-9-14(16)17/h5-6,9-10,12-13,15H,3-4,7-8,11H2,1-2H3 |
| InChIKey | YGMGQCMNPOHERX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |