C46H63IN2O12 — CID 160867076
tert-butyl 6-iodohexanoate;8-O-tert-butyl 1-O-methyl 2-(1-methoxycarbonylindol-3-yl)octanedioate;methyl 3-(2-methoxy-2-oxoethyl)indole-1-carboxylate (PubChem CID 160867076) has the molecular formula C46H63IN2O12 and a molecular weight of 962.92 g/mol. Its IUPAC name is tert-butyl 6-iodohexanoate;8-O-tert-butyl 1-O-methyl 2-(1-methoxycarbonylindol-3-yl)octanedioate;methyl 3-(2-methoxy-2-oxoethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 6-iodohexanoate;8-O-tert-butyl 1-O-methyl 2-(1-methoxycarbonylindol-3-yl)octanedioate;methyl 3-(2-methoxy-2-oxoethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 160867076 |
| Molecular Formula | C46H63IN2O12 |
| Molecular Weight | 962.92 g/mol |
| Exact Mass | 962.34 |
| IUPAC Name | tert-butyl 6-iodohexanoate;8-O-tert-butyl 1-O-methyl 2-(1-methoxycarbonylindol-3-yl)octanedioate;methyl 3-(2-methoxy-2-oxoethyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)CCCCCI.COC(=O)C(CCCCCC(=O)OC(C)(C)C)c1cn(C(=O)OC)c2ccccc12.COC(=O)Cc1cn(C(=O)OC)c2ccccc12 |
| InChI | InChI=1S/C23H31NO6.C13H13NO4.C10H19IO2/c1-23(2,3)30-20(25)14-8-6-7-12-17(21(26)28-4)18-15-24(22(27)29-5)19-13-10-9-11-16(18)19;1-17-12(15)7-9-8-14(13(16)18-2)11-6-4-3-5-10(9)11;1-10(2,3)13-9(12)7-5-4-6-8-11/h9-11,13,15,17H,6-8,12,14H2,1-5H3;3-6,8H,7H2,1-2H3;4-8H2,1-3H3 |
| InChIKey | SLGIZHCZLMWUOB-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 167.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.92 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|