C43H58N2O10 — CID 157221097
8-O-tert-butyl 1-O-methyl 2-(1-methoxycarbonylindol-3-yl)octanedioate;2-(1H-indol-3-yl)-8-[(2-methylpropan-2-yl)oxy]-8-oxooctanoic acid (PubChem CID 157221097) has the molecular formula C43H58N2O10 and a molecular weight of 762.94 g/mol. Its IUPAC name is 8-O-tert-butyl 1-O-methyl 2-(1-methoxycarbonylindol-3-yl)octanedioate;2-(1H-indol-3-yl)-8-[(2-methylpropan-2-yl)oxy]-8-oxooctanoic acid.
| Compound Name | 8-O-tert-butyl 1-O-methyl 2-(1-methoxycarbonylindol-3-yl)octanedioate;2-(1H-indol-3-yl)-8-[(2-methylpropan-2-yl)oxy]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 157221097 |
| Molecular Formula | C43H58N2O10 |
| Molecular Weight | 762.94 g/mol |
| Exact Mass | 762.41 |
| IUPAC Name | 8-O-tert-butyl 1-O-methyl 2-(1-methoxycarbonylindol-3-yl)octanedioate;2-(1H-indol-3-yl)-8-[(2-methylpropan-2-yl)oxy]-8-oxooctanoic acid |
| SMILES | CC(C)(C)OC(=O)CCCCCC(C(=O)O)c1c[nH]c2ccccc12.COC(=O)C(CCCCCC(=O)OC(C)(C)C)c1cn(C(=O)OC)c2ccccc12 |
| InChI | InChI=1S/C23H31NO6.C20H27NO4/c1-23(2,3)30-20(25)14-8-6-7-12-17(21(26)28-4)18-15-24(22(27)29-5)19-13-10-9-11-16(18)19;1-20(2,3)25-18(22)12-6-4-5-10-15(19(23)24)16-13-21-17-11-8-7-9-14(16)17/h9-11,13,15,17H,6-8,12,14H2,1-5H3;7-9,11,13,15,21H,4-6,10,12H2,1-3H3,(H,23,24) |
| InChIKey | ASZOYWJRXPMJNW-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 163.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.94 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|