C18H24N2O4 — CID 158232060
methyl 3-amino-2-[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1H-indol-3-yl]propanoate (PubChem CID 158232060) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 3-amino-2-[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1H-indol-3-yl]propanoate.
| Compound Name | methyl 3-amino-2-[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 158232060 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | methyl 3-amino-2-[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1H-indol-3-yl]propanoate |
| SMILES | COC(=O)C(CN)c1c[nH]c2ccc(CC(=O)OC(C)(C)C)cc12 |
| InChI | InChI=1S/C18H24N2O4/c1-18(2,3)24-16(21)8-11-5-6-15-12(7-11)14(10-20-15)13(9-19)17(22)23-4/h5-7,10,13,20H,8-9,19H2,1-4H3 |
| InChIKey | GEMODSZXFZNMFT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |