C18H23N3O6 — CID 157107690
methyl (2S)-2-[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-indol-3-yl]-3-nitropropanoate (PubChem CID 157107690) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is methyl (2S)-2-[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-indol-3-yl]-3-nitropropanoate.
| Compound Name | methyl (2S)-2-[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-indol-3-yl]-3-nitropropanoate |
|---|---|
| PubChem CID | 157107690 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | methyl (2S)-2-[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-indol-3-yl]-3-nitropropanoate |
| SMILES | COC(=O)[C@H](C[N+](=O)[O-])c1c[nH]c2ccc(CNC(=O)OC(C)(C)C)cc12 |
| InChI | InChI=1S/C18H23N3O6/c1-18(2,3)27-17(23)20-8-11-5-6-15-12(7-11)13(9-19-15)14(10-21(24)25)16(22)26-4/h5-7,9,14,19H,8,10H2,1-4H3,(H,20,23)/t14-/m1/s1 |
| InChIKey | AGMJBBAOHUPKAV-CQSZACIVSA-N |
| XLogP | 2.73 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|