C18H20ClF3N4O2 — CID 67484055
methyl 2-[3-chloro-4-[5-(trifluoromethyl)tetrazol-5-yl]phenyl]-3-cyclohexylpropanoate (PubChem CID 67484055) has the molecular formula C18H20ClF3N4O2 and a molecular weight of 416.83 g/mol. Its IUPAC name is methyl 2-[3-chloro-4-[5-(trifluoromethyl)tetrazol-5-yl]phenyl]-3-cyclohexylpropanoate.
| Compound Name | methyl 2-[3-chloro-4-[5-(trifluoromethyl)tetrazol-5-yl]phenyl]-3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 67484055 |
| Molecular Formula | C18H20ClF3N4O2 |
| Molecular Weight | 416.83 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | methyl 2-[3-chloro-4-[5-(trifluoromethyl)tetrazol-5-yl]phenyl]-3-cyclohexylpropanoate |
| SMILES | COC(=O)C(CC1CCCCC1)c1ccc(C2(C(F)(F)F)N=NN=N2)c(Cl)c1 |
| InChI | InChI=1S/C18H20ClF3N4O2/c1-28-16(27)13(9-11-5-3-2-4-6-11)12-7-8-14(15(19)10-12)17(18(20,21)22)23-25-26-24-17/h7-8,10-11,13H,2-6,9H2,1H3 |
| InChIKey | KQOHGUXEFBJJCU-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 75.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.83 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |