C15H20O4S — CID 174406760
(2R)-3-cyclopentyl-2-[4-(sulfinomethyl)phenyl]propanoic acid (PubChem CID 174406760) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is (2R)-3-cyclopentyl-2-[4-(sulfinomethyl)phenyl]propanoic acid.
| Compound Name | (2R)-3-cyclopentyl-2-[4-(sulfinomethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 174406760 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (2R)-3-cyclopentyl-2-[4-(sulfinomethyl)phenyl]propanoic acid |
| SMILES | O=C(O)[C@H](CC1CCCC1)c1ccc(CS(=O)O)cc1 |
| InChI | InChI=1S/C15H20O4S/c16-15(17)14(9-11-3-1-2-4-11)13-7-5-12(6-8-13)10-20(18)19/h5-8,11,14H,1-4,9-10H2,(H,16,17)(H,18,19)/t14-/m1/s1 |
| InChIKey | CSWQAQGUBWDTPC-CQSZACIVSA-N |
| XLogP | 3.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|