C22H26N2O5S — CID 174382331
[4-[3-cyclopentyl-1-[(5-methoxycarbonyl-2-pyridinyl)amino]-1-oxopropan-2-yl]phenyl]methanesulfinic acid (PubChem CID 174382331) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is [4-[3-cyclopentyl-1-[(5-methoxycarbonyl-2-pyridinyl)amino]-1-oxopropan-2-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[3-cyclopentyl-1-[(5-methoxycarbonyl-2-pyridinyl)amino]-1-oxopropan-2-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174382331 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [4-[3-cyclopentyl-1-[(5-methoxycarbonyl-2-pyridinyl)amino]-1-oxopropan-2-yl]phenyl]methanesulfinic acid |
| SMILES | COC(=O)c1ccc(NC(=O)C(CC2CCCC2)c2ccc(CS(=O)O)cc2)nc1 |
| InChI | InChI=1S/C22H26N2O5S/c1-29-22(26)18-10-11-20(23-13-18)24-21(25)19(12-15-4-2-3-5-15)17-8-6-16(7-9-17)14-30(27)28/h6-11,13,15,19H,2-5,12,14H2,1H3,(H,27,28)(H,23,24,25) |
| InChIKey | TYAWTYIQIQOHHY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|