C21H25N2O5S2- — CID 174372074
[4-[3-cyclopentyl-1-[(4-ethoxycarbonyl-1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl]phenyl]methanesulfinate (PubChem CID 174372074) has the molecular formula C21H25N2O5S2- and a molecular weight of 449.57 g/mol. Its IUPAC name is [4-[3-cyclopentyl-1-[(4-ethoxycarbonyl-1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl]phenyl]methanesulfinate.
| Compound Name | [4-[3-cyclopentyl-1-[(4-ethoxycarbonyl-1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174372074 |
| Molecular Formula | C21H25N2O5S2- |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | [4-[3-cyclopentyl-1-[(4-ethoxycarbonyl-1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl]phenyl]methanesulfinate |
| SMILES | CCOC(=O)c1csc(NC(=O)C(CC2CCCC2)c2ccc(CS(=O)[O-])cc2)n1 |
| InChI | InChI=1S/C21H26N2O5S2/c1-2-28-20(25)18-12-29-21(22-18)23-19(24)17(11-14-5-3-4-6-14)16-9-7-15(8-10-16)13-30(26)27/h7-10,12,14,17H,2-6,11,13H2,1H3,(H,26,27)(H,22,23,24)/p-1 |
| InChIKey | MDZUHAAAHGNFCC-UHFFFAOYSA-M |
| XLogP | 4.00 |
| TPSA | 108.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|