C22H28N2O5S2 — CID 174382058
[4-[1-[[4-(2-acetyloxyethyl)-1,3-thiazol-2-yl]amino]-3-cyclopentyl-1-oxopropan-2-yl]phenyl]methanesulfinic acid (PubChem CID 174382058) has the molecular formula C22H28N2O5S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is [4-[1-[[4-(2-acetyloxyethyl)-1,3-thiazol-2-yl]amino]-3-cyclopentyl-1-oxopropan-2-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[1-[[4-(2-acetyloxyethyl)-1,3-thiazol-2-yl]amino]-3-cyclopentyl-1-oxopropan-2-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174382058 |
| Molecular Formula | C22H28N2O5S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [4-[1-[[4-(2-acetyloxyethyl)-1,3-thiazol-2-yl]amino]-3-cyclopentyl-1-oxopropan-2-yl]phenyl]methanesulfinic acid |
| SMILES | CC(=O)OCCc1csc(NC(=O)C(CC2CCCC2)c2ccc(CS(=O)O)cc2)n1 |
| InChI | InChI=1S/C22H28N2O5S2/c1-15(25)29-11-10-19-13-30-22(23-19)24-21(26)20(12-16-4-2-3-5-16)18-8-6-17(7-9-18)14-31(27)28/h6-9,13,16,20H,2-5,10-12,14H2,1H3,(H,27,28)(H,23,24,26) |
| InChIKey | YZKQSQSGFPBJQI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|