C19H23N2O4S2- — CID 174374218
[4-[3-cyclopentyl-1-[[4-(hydroxymethyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]phenyl]methanesulfinate (PubChem CID 174374218) has the molecular formula C19H23N2O4S2- and a molecular weight of 407.54 g/mol. Its IUPAC name is [4-[3-cyclopentyl-1-[[4-(hydroxymethyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]phenyl]methanesulfinate.
| Compound Name | [4-[3-cyclopentyl-1-[[4-(hydroxymethyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174374218 |
| Molecular Formula | C19H23N2O4S2- |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [4-[3-cyclopentyl-1-[[4-(hydroxymethyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]phenyl]methanesulfinate |
| SMILES | O=C(Nc1nc(CO)cs1)C(CC1CCCC1)c1ccc(CS(=O)[O-])cc1 |
| InChI | InChI=1S/C19H24N2O4S2/c22-10-16-11-26-19(20-16)21-18(23)17(9-13-3-1-2-4-13)15-7-5-14(6-8-15)12-27(24)25/h5-8,11,13,17,22H,1-4,9-10,12H2,(H,24,25)(H,20,21,23)/p-1 |
| InChIKey | UDLHMRHDKMFYRR-UHFFFAOYSA-M |
| XLogP | 3.32 |
| TPSA | 102.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|