C23H30ClN3O4S — CID 142905786
2-(3-chloro-4-methylsulfinylphenyl)-3-cyclopentyl-N-[5-(2,2-dimethoxyethyl)pyrazin-2-yl]propanamide (PubChem CID 142905786) has the molecular formula C23H30ClN3O4S and a molecular weight of 480.03 g/mol. Its IUPAC name is 2-(3-chloro-4-methylsulfinylphenyl)-3-cyclopentyl-N-[5-(2,2-dimethoxyethyl)pyrazin-2-yl]propanamide.
| Compound Name | 2-(3-chloro-4-methylsulfinylphenyl)-3-cyclopentyl-N-[5-(2,2-dimethoxyethyl)pyrazin-2-yl]propanamide |
|---|---|
| PubChem CID | 142905786 |
| Molecular Formula | C23H30ClN3O4S |
| Molecular Weight | 480.03 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-(3-chloro-4-methylsulfinylphenyl)-3-cyclopentyl-N-[5-(2,2-dimethoxyethyl)pyrazin-2-yl]propanamide |
| SMILES | COC(Cc1cnc(NC(=O)C(CC2CCCC2)c2ccc(S(C)=O)c(Cl)c2)cn1)OC |
| InChI | InChI=1S/C23H30ClN3O4S/c1-30-22(31-2)12-17-13-26-21(14-25-17)27-23(28)18(10-15-6-4-5-7-15)16-8-9-20(32(3)29)19(24)11-16/h8-9,11,13-15,18,22H,4-7,10,12H2,1-3H3,(H,26,27,28) |
| InChIKey | KHVSWVWVPQTQDL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.03 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|