C23H30ClN3O5S — CID 174478253
(3R)-3-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-(2,2-dimethoxyethyl)pyrazin-2-yl]propanamide (PubChem CID 174478253) has the molecular formula C23H30ClN3O5S and a molecular weight of 496.03 g/mol. Its IUPAC name is (3R)-3-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-(2,2-dimethoxyethyl)pyrazin-2-yl]propanamide.
| Compound Name | (3R)-3-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-(2,2-dimethoxyethyl)pyrazin-2-yl]propanamide |
|---|---|
| PubChem CID | 174478253 |
| Molecular Formula | C23H30ClN3O5S |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | (3R)-3-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-(2,2-dimethoxyethyl)pyrazin-2-yl]propanamide |
| SMILES | COC(Cc1cnc(NC(=O)C[C@@H](c2ccc(S(C)(=O)=O)c(Cl)c2)C2CCCC2)cn1)OC |
| InChI | InChI=1S/C23H30ClN3O5S/c1-31-23(32-2)11-17-13-26-21(14-25-17)27-22(28)12-18(15-6-4-5-7-15)16-8-9-20(19(24)10-16)33(3,29)30/h8-10,13-15,18,23H,4-7,11-12H2,1-3H3,(H,26,27,28)/t18-/m1/s1 |
| InChIKey | XNWAWIZUBWCFJD-GOSISDBHSA-N |
| XLogP | 4.00 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|