C21H25ClN4O4S — CID 174437054
(3R)-3-(3-chloro-4-methylsulfonylphenyl)-3-(4-hydroxyiminocyclohexyl)-N-(5-methylpyrazin-2-yl)propanamide (PubChem CID 174437054) has the molecular formula C21H25ClN4O4S and a molecular weight of 464.98 g/mol. Its IUPAC name is (3R)-3-(3-chloro-4-methylsulfonylphenyl)-3-(4-hydroxyiminocyclohexyl)-N-(5-methylpyrazin-2-yl)propanamide.
| Compound Name | (3R)-3-(3-chloro-4-methylsulfonylphenyl)-3-(4-hydroxyiminocyclohexyl)-N-(5-methylpyrazin-2-yl)propanamide |
|---|---|
| PubChem CID | 174437054 |
| Molecular Formula | C21H25ClN4O4S |
| Molecular Weight | 464.98 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (3R)-3-(3-chloro-4-methylsulfonylphenyl)-3-(4-hydroxyiminocyclohexyl)-N-(5-methylpyrazin-2-yl)propanamide |
| SMILES | Cc1cnc(NC(=O)C[C@@H](c2ccc(S(C)(=O)=O)c(Cl)c2)C2CCC(=NO)CC2)cn1 |
| InChI | InChI=1S/C21H25ClN4O4S/c1-13-11-24-20(12-23-13)25-21(27)10-17(14-3-6-16(26-28)7-4-14)15-5-8-19(18(22)9-15)31(2,29)30/h5,8-9,11-12,14,17,28H,3-4,6-7,10H2,1-2H3,(H,24,25,27)/b26-16-/t14?,17-/m1/s1 |
| InChIKey | UQEZUWQRZROOHB-HQTCBYSZSA-N |
| XLogP | 3.97 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.98 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|