C27H28N2O4 — CID 67483378
methyl 6-[[3-cyclopentyl-2-(4-phenoxyphenyl)propanoyl]amino]pyridine-3-carboxylate (PubChem CID 67483378) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is methyl 6-[[3-cyclopentyl-2-(4-phenoxyphenyl)propanoyl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[3-cyclopentyl-2-(4-phenoxyphenyl)propanoyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 67483378 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | methyl 6-[[3-cyclopentyl-2-(4-phenoxyphenyl)propanoyl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)C(CC2CCCC2)c2ccc(Oc3ccccc3)cc2)nc1 |
| InChI | InChI=1S/C27H28N2O4/c1-32-27(31)21-13-16-25(28-18-21)29-26(30)24(17-19-7-5-6-8-19)20-11-14-23(15-12-20)33-22-9-3-2-4-10-22/h2-4,9-16,18-19,24H,5-8,17H2,1H3,(H,28,29,30) |
| InChIKey | PKCRIRJUBMVSHR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |