C17H24O5S — CID 67188953
methyl 2-(3-methyl-4-methylsulfonylphenyl)-3-(oxan-4-yl)propanoate (PubChem CID 67188953) has the molecular formula C17H24O5S and a molecular weight of 340.44 g/mol. Its IUPAC name is methyl 2-(3-methyl-4-methylsulfonylphenyl)-3-(oxan-4-yl)propanoate.
| Compound Name | methyl 2-(3-methyl-4-methylsulfonylphenyl)-3-(oxan-4-yl)propanoate |
|---|---|
| PubChem CID | 67188953 |
| Molecular Formula | C17H24O5S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | methyl 2-(3-methyl-4-methylsulfonylphenyl)-3-(oxan-4-yl)propanoate |
| SMILES | COC(=O)C(CC1CCOCC1)c1ccc(S(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C17H24O5S/c1-12-10-14(4-5-16(12)23(3,19)20)15(17(18)21-2)11-13-6-8-22-9-7-13/h4-5,10,13,15H,6-9,11H2,1-3H3 |
| InChIKey | MHHRSFLITPFXNR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |